C20H18Cl2N4O4 — CID 155234443
N-[(3R,6S)-6-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]oxan-3-yl]-2-[(6-chloro-3-pyridinyl)oxy]acetamide (PubChem CID 155234443) has the molecular formula C20H18Cl2N4O4 and a molecular weight of 449.29 g/mol. Its IUPAC name is N-[(3R,6S)-6-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]oxan-3-yl]-2-[(6-chloro-3-pyridinyl)oxy]acetamide.
| Compound Name | N-[(3R,6S)-6-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]oxan-3-yl]-2-[(6-chloro-3-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 155234443 |
| Molecular Formula | C20H18Cl2N4O4 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N-[(3R,6S)-6-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]oxan-3-yl]-2-[(6-chloro-3-pyridinyl)oxy]acetamide |
| SMILES | O=C(COc1ccc(Cl)nc1)N[C@@H]1CC[C@@H](c2nnc(-c3ccc(Cl)cc3)o2)OC1 |
| InChI | InChI=1S/C20H18Cl2N4O4/c21-13-3-1-12(2-4-13)19-25-26-20(30-19)16-7-5-14(10-29-16)24-18(27)11-28-15-6-8-17(22)23-9-15/h1-4,6,8-9,14,16H,5,7,10-11H2,(H,24,27)/t14-,16+/m1/s1 |
| InChIKey | HYDNJTRBXUHPPO-ZBFHGGJFSA-N |
| XLogP | 3.85 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|