C20H19NO4S — CID 16509450
2-(1,3-dioxoisoindol-2-yl)ethyl 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate (PubChem CID 16509450) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 16509450 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxylate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C20H19NO4S/c22-18-14-7-4-5-8-15(14)19(23)21(18)10-11-25-20(24)17-12-13-6-2-1-3-9-16(13)26-17/h4-5,7-8,12H,1-3,6,9-11H2 |
| InChIKey | OSBGXMNZLILZNK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|