C27H33N5O3 — CID 165114237
1-[3-[3-[(9S)-9,12-dimethyl-7-(oxan-4-yl)-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]azetidin-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 165114237) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-[3-[3-[(9S)-9,12-dimethyl-7-(oxan-4-yl)-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]azetidin-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[3-[(9S)-9,12-dimethyl-7-(oxan-4-yl)-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]azetidin-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 165114237 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 1-[3-[3-[(9S)-9,12-dimethyl-7-(oxan-4-yl)-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]azetidin-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(N2CC(c3cc4c(c(C)n3)O[C@@H](C)c3c(C5CCOCC5)ccnc3N4)C2)C1 |
| InChI | InChI=1S/C27H33N5O3/c1-4-24(33)32-14-20(15-32)31-12-19(13-31)22-11-23-26(16(2)29-22)35-17(3)25-21(5-8-28-27(25)30-23)18-6-9-34-10-7-18/h4-5,8,11,17-20H,1,6-7,9-10,12-15H2,2-3H3,(H,28,30)/t17-/m0/s1 |
| InChIKey | HSPGZXDOBDDPIE-KRWDZBQOSA-N |
| XLogP | 3.67 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|