C29H36N6O3 — CID 165115203
1-[3-[4-[(9S)-9,12-dimethyl-7-morpholin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]piperidin-1-yl]azetidin-1-yl]but-2-yn-1-one (PubChem CID 165115203) has the molecular formula C29H36N6O3 and a molecular weight of 516.65 g/mol. Its IUPAC name is 1-[3-[4-[(9S)-9,12-dimethyl-7-morpholin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]piperidin-1-yl]azetidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[3-[4-[(9S)-9,12-dimethyl-7-morpholin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]piperidin-1-yl]azetidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 165115203 |
| Molecular Formula | C29H36N6O3 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 1-[3-[4-[(9S)-9,12-dimethyl-7-morpholin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]piperidin-1-yl]azetidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CC(N2CCC(c3cc4c(c(C)n3)O[C@@H](C)c3c(N5CCOCC5)ccnc3N4)CC2)C1 |
| InChI | InChI=1S/C29H36N6O3/c1-4-5-26(36)35-17-22(18-35)33-10-7-21(8-11-33)23-16-24-28(19(2)31-23)38-20(3)27-25(6-9-30-29(27)32-24)34-12-14-37-15-13-34/h6,9,16,20-22H,7-8,10-15,17-18H2,1-3H3,(H,30,32)/t20-/m0/s1 |
| InChIKey | CJDNFXDLUKGYJL-FQEVSTJZSA-N |
| XLogP | 3.23 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|