C21H27N5O2 — CID 165114377
9-methyl-7-morpholin-4-yl-14-piperidin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene (PubChem CID 165114377) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 9-methyl-7-morpholin-4-yl-14-piperidin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene.
| Compound Name | 9-methyl-7-morpholin-4-yl-14-piperidin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
|---|---|
| PubChem CID | 165114377 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 9-methyl-7-morpholin-4-yl-14-piperidin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
| SMILES | CC1Oc2cnc(C3CCNCC3)cc2Nc2nccc(N3CCOCC3)c21 |
| InChI | InChI=1S/C21H27N5O2/c1-14-20-18(26-8-10-27-11-9-26)4-7-23-21(20)25-17-12-16(24-13-19(17)28-14)15-2-5-22-6-3-15/h4,7,12-15,22H,2-3,5-6,8-11H2,1H3,(H,23,25) |
| InChIKey | XTIXZBXFIXVNMK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |