C25H34N6O2 — CID 165115467
12-methyl-7-morpholin-4-yl-14-[1-[(3R)-pyrrolidin-3-yl]piperidin-4-yl]-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene (PubChem CID 165115467) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 12-methyl-7-morpholin-4-yl-14-[1-[(3R)-pyrrolidin-3-yl]piperidin-4-yl]-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene.
| Compound Name | 12-methyl-7-morpholin-4-yl-14-[1-[(3R)-pyrrolidin-3-yl]piperidin-4-yl]-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
|---|---|
| PubChem CID | 165115467 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 12-methyl-7-morpholin-4-yl-14-[1-[(3R)-pyrrolidin-3-yl]piperidin-4-yl]-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
| SMILES | Cc1nc(C2CCN([C@@H]3CCNC3)CC2)cc2c1OCc1c(N3CCOCC3)ccnc1N2 |
| InChI | InChI=1S/C25H34N6O2/c1-17-24-22(14-21(28-17)18-4-8-30(9-5-18)19-2-6-26-15-19)29-25-20(16-33-24)23(3-7-27-25)31-10-12-32-13-11-31/h3,7,14,18-19,26H,2,4-6,8-13,15-16H2,1H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | IAQVLXZINRQBPR-LJQANCHMSA-N |
| XLogP | 2.80 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |