C21H25N5O2S2 — CID 165115277
13-cyclopropyl-7-morpholin-4-yl-15-(1-sulfanylazetidin-3-yl)-11-oxa-10-thia-2,4,14-triazatricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,12,14-hexaene (PubChem CID 165115277) has the molecular formula C21H25N5O2S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 13-cyclopropyl-7-morpholin-4-yl-15-(1-sulfanylazetidin-3-yl)-11-oxa-10-thia-2,4,14-triazatricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,12,14-hexaene.
| Compound Name | 13-cyclopropyl-7-morpholin-4-yl-15-(1-sulfanylazetidin-3-yl)-11-oxa-10-thia-2,4,14-triazatricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,12,14-hexaene |
|---|---|
| PubChem CID | 165115277 |
| Molecular Formula | C21H25N5O2S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 13-cyclopropyl-7-morpholin-4-yl-15-(1-sulfanylazetidin-3-yl)-11-oxa-10-thia-2,4,14-triazatricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,12,14-hexaene |
| SMILES | SN1CC(c2cc3c(c(C4CC4)n2)OSCc2c(N4CCOCC4)ccnc2N3)C1 |
| InChI | InChI=1S/C21H25N5O2S2/c29-26-10-14(11-26)16-9-17-20(19(23-16)13-1-2-13)28-30-12-15-18(3-4-22-21(15)24-17)25-5-7-27-8-6-25/h3-4,9,13-14,29H,1-2,5-8,10-12H2,(H,22,24) |
| InChIKey | HVEXMDJFAOUMSF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|