C27H33N3O — CID 165116211
2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-[(3S)-3-propan-2-ylpiperazin-1-yl]benzamide (PubChem CID 165116211) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-[(3S)-3-propan-2-ylpiperazin-1-yl]benzamide.
| Compound Name | 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-[(3S)-3-propan-2-ylpiperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 165116211 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 2-methyl-N-[(1R)-1-naphthalen-1-ylethyl]-5-[(3S)-3-propan-2-ylpiperazin-1-yl]benzamide |
| SMILES | Cc1ccc(N2CCN[C@@H](C(C)C)C2)cc1C(=O)N[C@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H33N3O/c1-18(2)26-17-30(15-14-28-26)22-13-12-19(3)25(16-22)27(31)29-20(4)23-11-7-9-21-8-5-6-10-24(21)23/h5-13,16,18,20,26,28H,14-15,17H2,1-4H3,(H,29,31)/t20-,26-/m1/s1 |
| InChIKey | MWNJHBJLRKHOHB-FQRUVTKNSA-N |
| XLogP | 5.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |