C26H29N7O3 — CID 165117772
(8R)-2-[[8-(azetidin-3-yloxy)-5-(2-azidopropan-2-yl)isoquinolin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one (PubChem CID 165117772) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is (8R)-2-[[8-(azetidin-3-yloxy)-5-(2-azidopropan-2-yl)isoquinolin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one.
| Compound Name | (8R)-2-[[8-(azetidin-3-yloxy)-5-(2-azidopropan-2-yl)isoquinolin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165117772 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (8R)-2-[[8-(azetidin-3-yloxy)-5-(2-azidopropan-2-yl)isoquinolin-3-yl]amino]-7,7,8-trimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| SMILES | C[C@@H]1c2nc(Nc3cc4c(C(C)(C)N=[N+]=[N-])ccc(OC5CNC5)c4cn3)ccc2C(=O)OC1(C)C |
| InChI | InChI=1S/C26H29N7O3/c1-14-23-16(24(34)36-26(14,4)5)6-9-21(31-23)30-22-10-17-18(13-29-22)20(35-15-11-28-12-15)8-7-19(17)25(2,3)32-33-27/h6-10,13-15,28H,11-12H2,1-5H3,(H,29,30,31)/t14-/m1/s1 |
| InChIKey | WTJCXSZRJPTDTE-CQSZACIVSA-N |
| XLogP | 5.32 |
| TPSA | 134.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|