C15H21ClN2O — CID 165117840
(Z)-1-[4-[(E)-4-aminohex-2-en-3-yl]-6-chloro-3-pyridinyl]but-1-en-1-ol (PubChem CID 165117840) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is (Z)-1-[4-[(E)-4-aminohex-2-en-3-yl]-6-chloro-3-pyridinyl]but-1-en-1-ol.
| Compound Name | (Z)-1-[4-[(E)-4-aminohex-2-en-3-yl]-6-chloro-3-pyridinyl]but-1-en-1-ol |
|---|---|
| PubChem CID | 165117840 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (Z)-1-[4-[(E)-4-aminohex-2-en-3-yl]-6-chloro-3-pyridinyl]but-1-en-1-ol |
| SMILES | C/C=C(\c1cc(Cl)ncc1/C(O)=C/CC)C(N)CC |
| InChI | InChI=1S/C15H21ClN2O/c1-4-7-14(19)12-9-18-15(16)8-11(12)10(5-2)13(17)6-3/h5,7-9,13,19H,4,6,17H2,1-3H3/b10-5+,14-7- |
| InChIKey | SNJPPMOTIYNYOC-WIEIUUMRSA-N |
| XLogP | 4.18 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|