C18H26BN5O3 — CID 165118847
tert-butyl N-[[4-(4-amino-2-methylphenyl)piperazin-1-yl]-cyanatoboranylidenemethyl]carbamate (PubChem CID 165118847) has the molecular formula C18H26BN5O3 and a molecular weight of 371.25 g/mol. Its IUPAC name is tert-butyl N-[[4-(4-amino-2-methylphenyl)piperazin-1-yl]-cyanatoboranylidenemethyl]carbamate.
| Compound Name | tert-butyl N-[[4-(4-amino-2-methylphenyl)piperazin-1-yl]-cyanatoboranylidenemethyl]carbamate |
|---|---|
| PubChem CID | 165118847 |
| Molecular Formula | C18H26BN5O3 |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | tert-butyl N-[[4-(4-amino-2-methylphenyl)piperazin-1-yl]-cyanatoboranylidenemethyl]carbamate |
| SMILES | Cc1cc(N)ccc1N1CCN(/C(=B/OC#N)NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H26BN5O3/c1-13-11-14(21)5-6-15(13)23-7-9-24(10-8-23)16(19-26-12-20)22-17(25)27-18(2,3)4/h5-6,11H,7-10,21H2,1-4H3,(H,22,25) |
| InChIKey | BXXXYXCAXUDXOO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|