C21H31ClN4O — CID 165120118
1-(4-chloro-3-methylphenyl)-N-methylmethanamine;formamide;5-methyl-2-piperidin-1-ylpyridine (PubChem CID 165120118) has the molecular formula C21H31ClN4O and a molecular weight of 390.96 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-N-methylmethanamine;formamide;5-methyl-2-piperidin-1-ylpyridine.
| Compound Name | 1-(4-chloro-3-methylphenyl)-N-methylmethanamine;formamide;5-methyl-2-piperidin-1-ylpyridine |
|---|---|
| PubChem CID | 165120118 |
| Molecular Formula | C21H31ClN4O |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-N-methylmethanamine;formamide;5-methyl-2-piperidin-1-ylpyridine |
| SMILES | CNCc1ccc(Cl)c(C)c1.Cc1ccc(N2CCCCC2)nc1.NC=O |
| InChI | InChI=1S/C11H16N2.C9H12ClN.CH3NO/c1-10-5-6-11(12-9-10)13-7-3-2-4-8-13;1-7-5-8(6-11-2)3-4-9(7)10;2-1-3/h5-6,9H,2-4,7-8H2,1H3;3-5,11H,6H2,1-2H3;1H,(H2,2,3) |
| InChIKey | MLJGFWIJCUSFIT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|