C27H27FN4O4 — CID 165120994
4-[(6-fluoro-2-pyridinyl)methyl]pyridine-2-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 165120994) has the molecular formula C27H27FN4O4 and a molecular weight of 490.54 g/mol. Its IUPAC name is 4-[(6-fluoro-2-pyridinyl)methyl]pyridine-2-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 4-[(6-fluoro-2-pyridinyl)methyl]pyridine-2-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 165120994 |
| Molecular Formula | C27H27FN4O4 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 4-[(6-fluoro-2-pyridinyl)methyl]pyridine-2-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)CCOc2ccc(C#CC(C)(C)O)cc21.NC(=O)c1cc(Cc2cccc(F)n2)ccn1 |
| InChI | InChI=1S/C15H17NO3.C12H10FN3O/c1-15(2,18)8-6-11-4-5-13-12(10-11)16(3)14(17)7-9-19-13;13-11-3-1-2-9(16-11)6-8-4-5-15-10(7-8)12(14)17/h4-5,10,18H,7,9H2,1-3H3;1-5,7H,6H2,(H2,14,17) |
| InChIKey | GBGBRBQQYRHTEK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|