C27H31N5O4 — CID 153359960
1-[(2,6-dimethylphenyl)methyl]-1,2,4-triazole-3-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 153359960) has the molecular formula C27H31N5O4 and a molecular weight of 489.58 g/mol. Its IUPAC name is 1-[(2,6-dimethylphenyl)methyl]-1,2,4-triazole-3-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 1-[(2,6-dimethylphenyl)methyl]-1,2,4-triazole-3-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 153359960 |
| Molecular Formula | C27H31N5O4 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 1-[(2,6-dimethylphenyl)methyl]-1,2,4-triazole-3-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)CCOc2ccc(C#CC(C)(C)O)cc21.Cc1cccc(C)c1Cn1cnc(C(N)=O)n1 |
| InChI | InChI=1S/C15H17NO3.C12H14N4O/c1-15(2,18)8-6-11-4-5-13-12(10-11)16(3)14(17)7-9-19-13;1-8-4-3-5-9(2)10(8)6-16-7-14-12(15-16)11(13)17/h4-5,10,18H,7,9H2,1-3H3;3-5,7H,6H2,1-2H3,(H2,13,17) |
| InChIKey | PHCGOZQXGPJBCN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|