C26H25FN4O5 — CID 165121128
4-[(2-fluoro-3-pyridinyl)oxy]pyridine-2-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 165121128) has the molecular formula C26H25FN4O5 and a molecular weight of 492.51 g/mol. Its IUPAC name is 4-[(2-fluoro-3-pyridinyl)oxy]pyridine-2-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 4-[(2-fluoro-3-pyridinyl)oxy]pyridine-2-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 165121128 |
| Molecular Formula | C26H25FN4O5 |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-[(2-fluoro-3-pyridinyl)oxy]pyridine-2-carboxamide;7-(3-hydroxy-3-methylbut-1-ynyl)-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)CCOc2ccc(C#CC(C)(C)O)cc21.NC(=O)c1cc(Oc2cccnc2F)ccn1 |
| InChI | InChI=1S/C15H17NO3.C11H8FN3O2/c1-15(2,18)8-6-11-4-5-13-12(10-11)16(3)14(17)7-9-19-13;12-10-9(2-1-4-15-10)17-7-3-5-14-8(6-7)11(13)16/h4-5,10,18H,7,9H2,1-3H3;1-6H,(H2,13,16) |
| InChIKey | IBJXETUJQHYHED-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|