C33H30N6O4 — CID 153359936
1-benzyl-1,2,4-triazole-3-carboxamide;5-methyl-7-(4-quinolin-6-yloxybut-1-ynyl)-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 153359936) has the molecular formula C33H30N6O4 and a molecular weight of 574.64 g/mol. Its IUPAC name is 1-benzyl-1,2,4-triazole-3-carboxamide;5-methyl-7-(4-quinolin-6-yloxybut-1-ynyl)-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 1-benzyl-1,2,4-triazole-3-carboxamide;5-methyl-7-(4-quinolin-6-yloxybut-1-ynyl)-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 153359936 |
| Molecular Formula | C33H30N6O4 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 1-benzyl-1,2,4-triazole-3-carboxamide;5-methyl-7-(4-quinolin-6-yloxybut-1-ynyl)-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)CCOc2ccc(C#CCCOc3ccc4ncccc4c3)cc21.NC(=O)c1ncn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C23H20N2O3.C10H10N4O/c1-25-21-15-17(7-10-22(21)28-14-11-23(25)26)5-2-3-13-27-19-8-9-20-18(16-19)6-4-12-24-20;11-9(15)10-12-7-14(13-10)6-8-4-2-1-3-5-8/h4,6-10,12,15-16H,3,11,13-14H2,1H3;1-5,7H,6H2,(H2,11,15) |
| InChIKey | DSALQLUHDGARNT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|