C25H32N8O2S — CID 168952303
1-benzyl-1,2,4-triazole-3-carboxamide;5-methyl-8-(2-pyrrolidin-1-ylethylamino)-2,3-dihydropyrido[4,3-b][1,4]thiazepin-4-one (PubChem CID 168952303) has the molecular formula C25H32N8O2S and a molecular weight of 508.65 g/mol. Its IUPAC name is 1-benzyl-1,2,4-triazole-3-carboxamide;5-methyl-8-(2-pyrrolidin-1-ylethylamino)-2,3-dihydropyrido[4,3-b][1,4]thiazepin-4-one.
| Compound Name | 1-benzyl-1,2,4-triazole-3-carboxamide;5-methyl-8-(2-pyrrolidin-1-ylethylamino)-2,3-dihydropyrido[4,3-b][1,4]thiazepin-4-one |
|---|---|
| PubChem CID | 168952303 |
| Molecular Formula | C25H32N8O2S |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 1-benzyl-1,2,4-triazole-3-carboxamide;5-methyl-8-(2-pyrrolidin-1-ylethylamino)-2,3-dihydropyrido[4,3-b][1,4]thiazepin-4-one |
| SMILES | CN1C(=O)CCSc2cc(NCCN3CCCC3)ncc21.NC(=O)c1ncn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H22N4OS.C10H10N4O/c1-18-12-11-17-14(10-13(12)21-9-4-15(18)20)16-5-8-19-6-2-3-7-19;11-9(15)10-12-7-14(13-10)6-8-4-2-1-3-5-8/h10-11H,2-9H2,1H3,(H,16,17);1-5,7H,6H2,(H2,11,15) |
| InChIKey | NXUKKOGMPNDBCL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |