C22H37N3O3 — CID 165121846
ethane;3-(formamidomethyl)-N-methylbenzamide;N-propan-2-ylcyclohexanecarboxamide (PubChem CID 165121846) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is ethane;3-(formamidomethyl)-N-methylbenzamide;N-propan-2-ylcyclohexanecarboxamide.
| Compound Name | ethane;3-(formamidomethyl)-N-methylbenzamide;N-propan-2-ylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 165121846 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | ethane;3-(formamidomethyl)-N-methylbenzamide;N-propan-2-ylcyclohexanecarboxamide |
| SMILES | CC.CC(C)NC(=O)C1CCCCC1.CNC(=O)c1cccc(CNC=O)c1 |
| InChI | InChI=1S/C10H12N2O2.C10H19NO.C2H6/c1-11-10(14)9-4-2-3-8(5-9)6-12-7-13;1-8(2)11-10(12)9-6-4-3-5-7-9;1-2/h2-5,7H,6H2,1H3,(H,11,14)(H,12,13);8-9H,3-7H2,1-2H3,(H,11,12);1-2H3 |
| InChIKey | RWPDJOPTTNMPGF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|