About ethene;1-methyl-5-methylsulfanylnaphthalene;propane
ethene;1-methyl-5-methylsulfanylnaphthalene;propane (PubChem CID 165122097) has the molecular formula C17H24S
and a molecular weight of 260.45 g/mol. Its IUPAC name is ethene;1-methyl-5-methylsulfanylnaphthalene;propane.
Molecular Properties
| Compound Name | ethene;1-methyl-5-methylsulfanylnaphthalene;propane |
| PubChem CID | 165122097 |
| Molecular Formula | C17H24S |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | ethene;1-methyl-5-methylsulfanylnaphthalene;propane |
| SMILES | C=C.CCC.CSc1cccc2c(C)cccc12 |
| InChI | InChI=1S/C12H12S.C3H8.C2H4/c1-9-5-3-7-11-10(9)6-4-8-12(11)13-2;1-3-2;1-2/h3-8H,1-2H3;3H2,1-2H3;1-2H2 |
| InChIKey | IMDZHHSAKRMKSO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-methyl-5-methylsulfanylnaphthalene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-methyl-5-methylsulfanylnaphthalene;propane?
The IUPAC name of ethene;1-methyl-5-methylsulfanylnaphthalene;propane (CID 165122097) is ethene;1-methyl-5-methylsulfanylnaphthalene;propane.
What is the SMILES notation for ethene;1-methyl-5-methylsulfanylnaphthalene;propane?
The canonical SMILES for ethene;1-methyl-5-methylsulfanylnaphthalene;propane is C=C.CCC.CSc1cccc2c(C)cccc12.
What is the InChIKey of ethene;1-methyl-5-methylsulfanylnaphthalene;propane?
The InChIKey is IMDZHHSAKRMKSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12S.C3H8.C2H4/c1-9-5-3-7-11-10(9)6-4-8-12(11)13-2;1-3-2;1-2/h3-8H,1-2H3;3H2,1-2H3;1-2H2.
What are the key properties of ethene;1-methyl-5-methylsulfanylnaphthalene;propane?
ethene;1-methyl-5-methylsulfanylnaphthalene;propane has a molecular weight of 260.45 g/mol, XLogP of 6.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-methyl-5-methylsulfanylnaphthalene;propane is sourced from PubChem (CID 165122097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).