C21H32O7 — CID 165125375
tert-butyl 3-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]oxirane-2-carboxylate (PubChem CID 165125375) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]oxirane-2-carboxylate.
| Compound Name | tert-butyl 3-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 165125375 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | tert-butyl 3-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]oxirane-2-carboxylate |
| SMILES | CCOCCOCCOCCOc1ccc(C2OC2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H32O7/c1-5-23-10-11-24-12-13-25-14-15-26-17-8-6-16(7-9-17)18-19(27-18)20(22)28-21(2,3)4/h6-9,18-19H,5,10-15H2,1-4H3 |
| InChIKey | IXFBGJYYKLAEQL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|