C14H16N4 — CID 165125795
3-imino-3-[6-(1-imino-3-methylbut-2-en-2-yl)-4-methyl-3-pyridinyl]propanenitrile (PubChem CID 165125795) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-imino-3-[6-(1-imino-3-methylbut-2-en-2-yl)-4-methyl-3-pyridinyl]propanenitrile.
| Compound Name | 3-imino-3-[6-(1-imino-3-methylbut-2-en-2-yl)-4-methyl-3-pyridinyl]propanenitrile |
|---|---|
| PubChem CID | 165125795 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-imino-3-[6-(1-imino-3-methylbut-2-en-2-yl)-4-methyl-3-pyridinyl]propanenitrile |
| SMILES | [H]/N=C/C(=C(C)C)c1cc(C)c(/C(CC#N)=N/[H])cn1 |
| InChI | InChI=1S/C14H16N4/c1-9(2)11(7-16)14-6-10(3)12(8-18-14)13(17)4-5-15/h6-8,16-17H,4H2,1-3H3/b16-7+,17-13+ |
| InChIKey | PNIBOTPFTQALOU-SAERGTNASA-N |
| XLogP | 3.11 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|