C23H26N8O — CID 165126629
2-ethyl-6-methyl-N-[[4-(7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide (PubChem CID 165126629) has the molecular formula C23H26N8O and a molecular weight of 430.52 g/mol. Its IUPAC name is 2-ethyl-6-methyl-N-[[4-(7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 2-ethyl-6-methyl-N-[[4-(7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 165126629 |
| Molecular Formula | C23H26N8O |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-ethyl-6-methyl-N-[[4-(7-methyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CCc1nc2ncc(C)cn2c1C(=O)NCc1ccc(-c2nc3n(n2)CCN(C)C3)cc1 |
| InChI | InChI=1S/C23H26N8O/c1-4-18-20(30-13-15(2)11-25-23(30)26-18)22(32)24-12-16-5-7-17(8-6-16)21-27-19-14-29(3)9-10-31(19)28-21/h5-8,11,13H,4,9-10,12,14H2,1-3H3,(H,24,32) |
| InChIKey | WVVQNKDZCHIHMO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |