C24H26N6O — CID 176614133
2-ethyl-N-[[4-[(7R)-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 176614133) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-ethyl-N-[[4-[(7R)-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-ethyl-N-[[4-[(7R)-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 176614133 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-ethyl-N-[[4-[(7R)-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]phenyl]methyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2ccccn2c1C(=O)NCc1ccc(-c2nc3n(n2)CC[C@@H](C)C3)cc1 |
| InChI | InChI=1S/C24H26N6O/c1-3-19-22(29-12-5-4-6-20(29)26-19)24(31)25-15-17-7-9-18(10-8-17)23-27-21-14-16(2)11-13-30(21)28-23/h4-10,12,16H,3,11,13-15H2,1-2H3,(H,25,31)/t16-/m1/s1 |
| InChIKey | GEIKISSRWUPUOD-MRXNPFEDSA-N |
| XLogP | 3.67 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |