C24H23F3N6O — CID 176614007
2-ethyl-N-[[4-[(7R)-7-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide (PubChem CID 176614007) has the molecular formula C24H23F3N6O and a molecular weight of 468.48 g/mol. Its IUPAC name is 2-ethyl-N-[[4-[(7R)-7-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 2-ethyl-N-[[4-[(7R)-7-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 176614007 |
| Molecular Formula | C24H23F3N6O |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-ethyl-N-[[4-[(7R)-7-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CCc1nc2ncccn2c1C(=O)NCc1ccc(-c2cn3c(n2)C[C@H](C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C24H23F3N6O/c1-2-18-21(33-10-3-9-28-23(33)31-18)22(34)29-13-15-4-6-16(7-5-15)19-14-32-11-8-17(24(25,26)27)12-20(32)30-19/h3-7,9-10,14,17H,2,8,11-13H2,1H3,(H,29,34)/t17-/m1/s1 |
| InChIKey | KTBLWEKNKLGDBE-QGZVFWFLSA-N |
| XLogP | 4.21 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |