C20H30F2N2 — CID 165128435
1-benzyl-4-[2-(4,4-difluorocyclohexyl)propan-2-yl]piperazine (PubChem CID 165128435) has the molecular formula C20H30F2N2 and a molecular weight of 336.47 g/mol. Its IUPAC name is 1-benzyl-4-[2-(4,4-difluorocyclohexyl)propan-2-yl]piperazine.
| Compound Name | 1-benzyl-4-[2-(4,4-difluorocyclohexyl)propan-2-yl]piperazine |
|---|---|
| PubChem CID | 165128435 |
| Molecular Formula | C20H30F2N2 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 1-benzyl-4-[2-(4,4-difluorocyclohexyl)propan-2-yl]piperazine |
| SMILES | CC(C)(C1CCC(F)(F)CC1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H30F2N2/c1-19(2,18-8-10-20(21,22)11-9-18)24-14-12-23(13-15-24)16-17-6-4-3-5-7-17/h3-7,18H,8-16H2,1-2H3 |
| InChIKey | KZAFOOKLURUNEO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |