C24H24ClN3O4S2 — CID 165130309
ethyl 2-[5-chloro-3-(4-ethoxy-3-methoxy-N-methylanilino)sulfanylthiophen-2-yl]-3H-benzimidazole-5-carboxylate (PubChem CID 165130309) has the molecular formula C24H24ClN3O4S2 and a molecular weight of 518.06 g/mol. Its IUPAC name is ethyl 2-[5-chloro-3-(4-ethoxy-3-methoxy-N-methylanilino)sulfanylthiophen-2-yl]-3H-benzimidazole-5-carboxylate.
| Compound Name | ethyl 2-[5-chloro-3-(4-ethoxy-3-methoxy-N-methylanilino)sulfanylthiophen-2-yl]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 165130309 |
| Molecular Formula | C24H24ClN3O4S2 |
| Molecular Weight | 518.06 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | ethyl 2-[5-chloro-3-(4-ethoxy-3-methoxy-N-methylanilino)sulfanylthiophen-2-yl]-3H-benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(-c3sc(Cl)cc3SN(C)c3ccc(OCC)c(OC)c3)[nH]c2c1 |
| InChI | InChI=1S/C24H24ClN3O4S2/c1-5-31-18-10-8-15(12-19(18)30-4)28(3)34-20-13-21(25)33-22(20)23-26-16-9-7-14(11-17(16)27-23)24(29)32-6-2/h7-13H,5-6H2,1-4H3,(H,26,27) |
| InChIKey | CXPPYSLDSJYTLV-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.06 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|