C18H23N9O2 — CID 165132125
2-[(Z)-2-amino-1-[[6-cyclopropyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methylamino]ethenyl]guanidine (PubChem CID 165132125) has the molecular formula C18H23N9O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 2-[(Z)-2-amino-1-[[6-cyclopropyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methylamino]ethenyl]guanidine.
| Compound Name | 2-[(Z)-2-amino-1-[[6-cyclopropyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methylamino]ethenyl]guanidine |
|---|---|
| PubChem CID | 165132125 |
| Molecular Formula | C18H23N9O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-[(Z)-2-amino-1-[[6-cyclopropyl-8-(3-methyl-2,4-dioxoimidazolidin-1-yl)imidazo[1,2-a]pyridin-2-yl]methylamino]ethenyl]guanidine |
| SMILES | CN1C(=O)CN(c2cc(C3CC3)cn3cc(CN/C(=C/N)N=C(N)N)nc23)C1=O |
| InChI | InChI=1S/C18H23N9O2/c1-25-15(28)9-27(18(25)29)13-4-11(10-2-3-10)7-26-8-12(23-16(13)26)6-22-14(5-19)24-17(20)21/h4-5,7-8,10,22H,2-3,6,9,19H2,1H3,(H4,20,21,24)/b14-5- |
| InChIKey | UHFLLXIBGSYSGZ-RZNTYIFUSA-N |
| XLogP | -0.27 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|