C21H21N5O3 — CID 165132489
1-[2-[(3-aminophenoxy)methyl]-6-cyclopropylimidazo[1,2-a]pyridin-8-yl]-3-methylimidazolidine-2,4-dione (PubChem CID 165132489) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 1-[2-[(3-aminophenoxy)methyl]-6-cyclopropylimidazo[1,2-a]pyridin-8-yl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 1-[2-[(3-aminophenoxy)methyl]-6-cyclopropylimidazo[1,2-a]pyridin-8-yl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 165132489 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-[2-[(3-aminophenoxy)methyl]-6-cyclopropylimidazo[1,2-a]pyridin-8-yl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN(c2cc(C3CC3)cn3cc(COc4cccc(N)c4)nc23)C1=O |
| InChI | InChI=1S/C21H21N5O3/c1-24-19(27)11-26(21(24)28)18-7-14(13-5-6-13)9-25-10-16(23-20(18)25)12-29-17-4-2-3-15(22)8-17/h2-4,7-10,13H,5-6,11-12,22H2,1H3 |
| InChIKey | HSERDGDNEJQASX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|