C24H17F2NO5S — CID 16513220
[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 16513220) has the molecular formula C24H17F2NO5S and a molecular weight of 469.47 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 16513220 |
| Molecular Formula | C24H17F2NO5S |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C(OC(C(=O)c1c[nH]c2ccccc12)c1ccccc1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C24H17F2NO5S/c25-24(26)33(30,31)17-12-10-16(11-13-17)23(29)32-22(15-6-2-1-3-7-15)21(28)19-14-27-20-9-5-4-8-18(19)20/h1-14,22,24,27H |
| InChIKey | IIVFUOWBCYXNRH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |