C30H24N2O5S — CID 16530105
[2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 3-[methyl(phenyl)sulfamoyl]benzoate (PubChem CID 16530105) has the molecular formula C30H24N2O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 3-[methyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 3-[methyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 16530105 |
| Molecular Formula | C30H24N2O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 3-[methyl(phenyl)sulfamoyl]benzoate |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)OC(C(=O)c2c[nH]c3ccccc23)c2ccccc2)c1 |
| InChI | InChI=1S/C30H24N2O5S/c1-32(23-14-6-3-7-15-23)38(35,36)24-16-10-13-22(19-24)30(34)37-29(21-11-4-2-5-12-21)28(33)26-20-31-27-18-9-8-17-25(26)27/h2-20,29,31H,1H3 |
| InChIKey | IUGRHWIERHOGBT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |