C27H26N2O5S — CID 2557318
[(1S)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4-(diethylsulfamoyl)benzoate (PubChem CID 2557318) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is [(1S)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [(1S)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2557318 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [(1S)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)O[C@H](C(=O)c2c[nH]c3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O5S/c1-3-29(4-2)35(32,33)21-16-14-20(15-17-21)27(31)34-26(19-10-6-5-7-11-19)25(30)23-18-28-24-13-9-8-12-22(23)24/h5-18,26,28H,3-4H2,1-2H3/t26-/m0/s1 |
| InChIKey | GSQHUQPIULXEGV-SANMLTNESA-N |
| XLogP | 4.98 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |