C9H12N2O2 — CID 165132311
2-cyclopropyl-4-methylpyrimidine;formic acid (PubChem CID 165132311) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-cyclopropyl-4-methylpyrimidine;formic acid.
| Compound Name | 2-cyclopropyl-4-methylpyrimidine;formic acid |
|---|---|
| PubChem CID | 165132311 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-cyclopropyl-4-methylpyrimidine;formic acid |
| SMILES | Cc1ccnc(C2CC2)n1.O=CO |
| InChI | InChI=1S/C8H10N2.CH2O2/c1-6-4-5-9-8(10-6)7-2-3-7;2-1-3/h4-5,7H,2-3H2,1H3;1H,(H,2,3) |
| InChIKey | FEFGWGIFKRDKLI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|