C16H22ClN5O — CID 165132649
N-(6-chloro-2-methylpyrimidin-4-yl)formamide;2-cyclopropyl-4-methylpyrimidine;ethane (PubChem CID 165132649) has the molecular formula C16H22ClN5O and a molecular weight of 335.84 g/mol. Its IUPAC name is N-(6-chloro-2-methylpyrimidin-4-yl)formamide;2-cyclopropyl-4-methylpyrimidine;ethane.
| Compound Name | N-(6-chloro-2-methylpyrimidin-4-yl)formamide;2-cyclopropyl-4-methylpyrimidine;ethane |
|---|---|
| PubChem CID | 165132649 |
| Molecular Formula | C16H22ClN5O |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-(6-chloro-2-methylpyrimidin-4-yl)formamide;2-cyclopropyl-4-methylpyrimidine;ethane |
| SMILES | CC.Cc1ccnc(C2CC2)n1.Cc1nc(Cl)cc(NC=O)n1 |
| InChI | InChI=1S/C8H10N2.C6H6ClN3O.C2H6/c1-6-4-5-9-8(10-6)7-2-3-7;1-4-9-5(7)2-6(10-4)8-3-11;1-2/h4-5,7H,2-3H2,1H3;2-3H,1H3,(H,8,9,10,11);1-2H3 |
| InChIKey | OFNLRELRZRIAAF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|