C15H15N3OS — CID 165133273
trans-(1S,2S)-2-(4-methylpyrimidin-2-yl)-N-(3-sulfanylphenyl)cyclopropane-1-carboxamide (PubChem CID 165133273) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-methylpyrimidin-2-yl)-N-(3-sulfanylphenyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(4-methylpyrimidin-2-yl)-N-(3-sulfanylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 165133273 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | trans-(1S,2S)-2-(4-methylpyrimidin-2-yl)-N-(3-sulfanylphenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1ccnc([C@H]2C[C@@H]2C(=O)Nc2cccc(S)c2)n1 |
| InChI | InChI=1S/C15H15N3OS/c1-9-5-6-16-14(17-9)12-8-13(12)15(19)18-10-3-2-4-11(20)7-10/h2-7,12-13,20H,8H2,1H3,(H,18,19)/t12-,13-/m0/s1 |
| InChIKey | UWHCEUJERNEXGP-STQMWFEESA-N |
| XLogP | 2.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|