C5H3BrCl5N2O2PS — CID 165133627
5-bromo-2-[(tetrachloro-λ5-phosphanyl)amino]pyridine-3-sulfonyl chloride (PubChem CID 165133627) has the molecular formula C5H3BrCl5N2O2PS and a molecular weight of 443.30 g/mol. Its IUPAC name is 5-bromo-2-[(tetrachloro-λ5-phosphanyl)amino]pyridine-3-sulfonyl chloride.
| Compound Name | 5-bromo-2-[(tetrachloro-λ5-phosphanyl)amino]pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 165133627 |
| Molecular Formula | C5H3BrCl5N2O2PS |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 439.73 |
| IUPAC Name | 5-bromo-2-[(tetrachloro-λ5-phosphanyl)amino]pyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(Br)cnc1NP(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H3BrCl5N2O2PS/c6-3-1-4(17(11,14)15)5(12-2-3)13-16(7,8,9)10/h1-2H,(H,12,13) |
| InChIKey | IYOGDQYKNOSIHZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|