C16H16N6O — CID 165133846
N-[4-[(6-cyclopropyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methylamino]-2-pyridinyl]formamide (PubChem CID 165133846) has the molecular formula C16H16N6O and a molecular weight of 308.34 g/mol. Its IUPAC name is N-[4-[(6-cyclopropyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methylamino]-2-pyridinyl]formamide.
| Compound Name | N-[4-[(6-cyclopropyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methylamino]-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 165133846 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[4-[(6-cyclopropyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methylamino]-2-pyridinyl]formamide |
| SMILES | O=CNc1cc(NCc2nc3ccc(C4CC4)cn3n2)ccn1 |
| InChI | InChI=1S/C16H16N6O/c23-10-19-14-7-13(5-6-17-14)18-8-15-20-16-4-3-12(11-1-2-11)9-22(16)21-15/h3-7,9-11H,1-2,8H2,(H2,17,18,19,23) |
| InChIKey | WANQFRCSAWRRID-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|