C44H47N7O4S — CID 165136388
N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]sulfanyl-4-[4-(2-hydroxy-2,2-diphenylethyl)piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 165136388) has the molecular formula C44H47N7O4S and a molecular weight of 769.97 g/mol. Its IUPAC name is N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]sulfanyl-4-[4-(2-hydroxy-2,2-diphenylethyl)piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]sulfanyl-4-[4-(2-hydroxy-2,2-diphenylethyl)piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 165136388 |
| Molecular Formula | C44H47N7O4S |
| Molecular Weight | 769.97 g/mol |
| Exact Mass | 769.34 |
| IUPAC Name | N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]sulfanyl-4-[4-(2-hydroxy-2,2-diphenylethyl)piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | Nc1cc(SNC(=O)c2ccc(N3CCN(CC(O)(c4ccccc4)c4ccccc4)CC3)cc2Oc2cnc3[nH]ccc3c2)ccc1NCC1CCOCC1 |
| InChI | InChI=1S/C44H47N7O4S/c45-39-27-37(12-14-40(39)47-28-31-16-23-54-24-17-31)56-49-43(52)38-13-11-35(26-41(38)55-36-25-32-15-18-46-42(32)48-29-36)51-21-19-50(20-22-51)30-44(53,33-7-3-1-4-8-33)34-9-5-2-6-10-34/h1-15,18,25-27,29,31,47,53H,16-17,19-24,28,30,45H2,(H,46,48)(H,49,52) |
| InChIKey | XBEQNBXYBAXLKY-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.97 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|