C30H34N4O2 — CID 165136389
2-(1H-indol-5-yloxy)-4-[4-[1-(4-methylphenyl)butyl]piperazin-1-yl]benzamide (PubChem CID 165136389) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-(1H-indol-5-yloxy)-4-[4-[1-(4-methylphenyl)butyl]piperazin-1-yl]benzamide.
| Compound Name | 2-(1H-indol-5-yloxy)-4-[4-[1-(4-methylphenyl)butyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 165136389 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 2-(1H-indol-5-yloxy)-4-[4-[1-(4-methylphenyl)butyl]piperazin-1-yl]benzamide |
| SMILES | CCCC(c1ccc(C)cc1)N1CCN(c2ccc(C(N)=O)c(Oc3ccc4[nH]ccc4c3)c2)CC1 |
| InChI | InChI=1S/C30H34N4O2/c1-3-4-28(22-7-5-21(2)6-8-22)34-17-15-33(16-18-34)24-9-11-26(30(31)35)29(20-24)36-25-10-12-27-23(19-25)13-14-32-27/h5-14,19-20,28,32H,3-4,15-18H2,1-2H3,(H2,31,35) |
| InChIKey | TXDUCDCVFFKYTA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |