About 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide
1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide (PubChem CID 165137094) has the molecular formula C12H25N3OS
and a molecular weight of 259.42 g/mol. Its IUPAC name is 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide.
Analyze 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide?
The IUPAC name of 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide (CID 165137094) is 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide.
What is the SMILES notation for 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide?
The canonical SMILES for 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide is CCN=S1(=O)CCN(CC2CCNCC2)CC1.
What is the InChIKey of 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide?
The InChIKey is NZHIZSUFOSIAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3OS/c1-2-14-17(16)9-7-15(8-10-17)11-12-3-5-13-6-4-12/h12-13H,2-11H2,1H3.
What are the key properties of 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide?
1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide has a molecular weight of 259.42 g/mol, XLogP of 0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylimino-4-(piperidin-4-ylmethyl)-1,4-thiazinane 1-oxide is sourced from PubChem (CID 165137094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).