C15H23N7O2 — CID 165138740
1-[(Z)-4-amino-3-hydrazinylbut-3-enoyl]-N-[(2-amino-3-pyridinyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 165138740) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 1-[(Z)-4-amino-3-hydrazinylbut-3-enoyl]-N-[(2-amino-3-pyridinyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(Z)-4-amino-3-hydrazinylbut-3-enoyl]-N-[(2-amino-3-pyridinyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 165138740 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-[(Z)-4-amino-3-hydrazinylbut-3-enoyl]-N-[(2-amino-3-pyridinyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | N/C=C(/CC(=O)N1CCCC1C(=O)NCc1cccnc1N)NN |
| InChI | InChI=1S/C15H23N7O2/c16-8-11(21-18)7-13(23)22-6-2-4-12(22)15(24)20-9-10-3-1-5-19-14(10)17/h1,3,5,8,12,21H,2,4,6-7,9,16,18H2,(H2,17,19)(H,20,24)/b11-8- |
| InChIKey | AROJSQHFACZZBQ-FLIBITNWSA-N |
| XLogP | -1.08 |
| TPSA | 152.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|