C19H21N3O4 — CID 75415776
1-(2-hydroxybenzoyl)-N-[(2-methoxy-3-pyridinyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 75415776) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-(2-hydroxybenzoyl)-N-[(2-methoxy-3-pyridinyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-hydroxybenzoyl)-N-[(2-methoxy-3-pyridinyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 75415776 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-(2-hydroxybenzoyl)-N-[(2-methoxy-3-pyridinyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ncccc1CNC(=O)C1CCCN1C(=O)c1ccccc1O |
| InChI | InChI=1S/C19H21N3O4/c1-26-18-13(6-4-10-20-18)12-21-17(24)15-8-5-11-22(15)19(25)14-7-2-3-9-16(14)23/h2-4,6-7,9-10,15,23H,5,8,11-12H2,1H3,(H,21,24) |
| InChIKey | BECYRXJUBUWENS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |