C11H18FN3 — CID 165140410
(1Z)-5-(3-fluoropyrrolidin-1-yl)-2-methanimidoylhexa-1,5-dien-1-amine (PubChem CID 165140410) has the molecular formula C11H18FN3 and a molecular weight of 211.28 g/mol. Its IUPAC name is (1Z)-5-(3-fluoropyrrolidin-1-yl)-2-methanimidoylhexa-1,5-dien-1-amine.
| Compound Name | (1Z)-5-(3-fluoropyrrolidin-1-yl)-2-methanimidoylhexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 165140410 |
| Molecular Formula | C11H18FN3 |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | (1Z)-5-(3-fluoropyrrolidin-1-yl)-2-methanimidoylhexa-1,5-dien-1-amine |
| SMILES | [H]/N=C/C(=C\N)CCC(=C)N1CCC(F)C1 |
| InChI | InChI=1S/C11H18FN3/c1-9(2-3-10(6-13)7-14)15-5-4-11(12)8-15/h6-7,11,13H,1-5,8,14H2/b10-7-,13-6+ |
| InChIKey | ICKBUQCQFLRFQV-SMWMWWBHSA-N |
| XLogP | 1.82 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|