C26H39NO3 — CID 165141094
ethane;N-methyl-1-[6-[(4-methylphenyl)methoxymethyl]oxan-2-yl]oxy-1-phenylpropan-2-amine (PubChem CID 165141094) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is ethane;N-methyl-1-[6-[(4-methylphenyl)methoxymethyl]oxan-2-yl]oxy-1-phenylpropan-2-amine.
| Compound Name | ethane;N-methyl-1-[6-[(4-methylphenyl)methoxymethyl]oxan-2-yl]oxy-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 165141094 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | ethane;N-methyl-1-[6-[(4-methylphenyl)methoxymethyl]oxan-2-yl]oxy-1-phenylpropan-2-amine |
| SMILES | CC.CNC(C)C(OC1CCCC(COCc2ccc(C)cc2)O1)c1ccccc1 |
| InChI | InChI=1S/C24H33NO3.C2H6/c1-18-12-14-20(15-13-18)16-26-17-22-10-7-11-23(27-22)28-24(19(2)25-3)21-8-5-4-6-9-21;1-2/h4-6,8-9,12-15,19,22-25H,7,10-11,16-17H2,1-3H3;1-2H3 |
| InChIKey | GPZBTJHTRQUVAM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |