C15H21BrO3 — CID 45113682
(2S,6S)-2-(2-bromoethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 45113682) has the molecular formula C15H21BrO3 and a molecular weight of 329.23 g/mol. Its IUPAC name is (2S,6S)-2-(2-bromoethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,6S)-2-(2-bromoethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 45113682 |
| Molecular Formula | C15H21BrO3 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | (2S,6S)-2-(2-bromoethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | BrCCO[C@@H]1CCC[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C15H21BrO3/c16-9-10-18-15-8-4-7-14(19-15)12-17-11-13-5-2-1-3-6-13/h1-3,5-6,14-15H,4,7-12H2/t14-,15-/m0/s1 |
| InChIKey | HEZWRKLWOFDICH-GJZGRUSLSA-N |
| XLogP | 3.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|