C18H24O2 — CID 102315294
(2R,6S)-2-[(1E,3E)-penta-1,3-dienyl]-6-(phenylmethoxymethyl)oxane (PubChem CID 102315294) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (2R,6S)-2-[(1E,3E)-penta-1,3-dienyl]-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,6S)-2-[(1E,3E)-penta-1,3-dienyl]-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 102315294 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2R,6S)-2-[(1E,3E)-penta-1,3-dienyl]-6-(phenylmethoxymethyl)oxane |
| SMILES | C/C=C/C=C/[C@H]1CCC[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C18H24O2/c1-2-3-5-11-17-12-8-13-18(20-17)15-19-14-16-9-6-4-7-10-16/h2-7,9-11,17-18H,8,12-15H2,1H3/b3-2+,11-5+/t17-,18-/m0/s1 |
| InChIKey | RFMQUKWQYNAETN-FMFHMCOLSA-N |
| XLogP | 4.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|