C15H23ClN2O — CID 165142296
4-[(2S,4R)-2-phenylpiperidin-4-yl]morpholine;hydrochloride (PubChem CID 165142296) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 4-[(2S,4R)-2-phenylpiperidin-4-yl]morpholine;hydrochloride.
| Compound Name | 4-[(2S,4R)-2-phenylpiperidin-4-yl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 165142296 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[(2S,4R)-2-phenylpiperidin-4-yl]morpholine;hydrochloride |
| SMILES | Cl.c1ccc([C@@H]2C[C@H](N3CCOCC3)CCN2)cc1 |
| InChI | InChI=1S/C15H22N2O.ClH/c1-2-4-13(5-3-1)15-12-14(6-7-16-15)17-8-10-18-11-9-17;/h1-5,14-16H,6-12H2;1H/t14-,15+;/m1./s1 |
| InChIKey | LCMNXVKXWRIVAL-LIOBNPLQSA-N |
| XLogP | 2.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |