C25H26F3N5O2 — CID 165142560
1-(imidazo[1,2-a]pyrazin-3-ylmethyl)-N-[(3Z)-6,6,6-trifluoro-4-methoxy-5,5-dimethylhexa-1,3-dien-2-yl]-2,3-dihydroindole-6-carboxamide (PubChem CID 165142560) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 1-(imidazo[1,2-a]pyrazin-3-ylmethyl)-N-[(3Z)-6,6,6-trifluoro-4-methoxy-5,5-dimethylhexa-1,3-dien-2-yl]-2,3-dihydroindole-6-carboxamide.
| Compound Name | 1-(imidazo[1,2-a]pyrazin-3-ylmethyl)-N-[(3Z)-6,6,6-trifluoro-4-methoxy-5,5-dimethylhexa-1,3-dien-2-yl]-2,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 165142560 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-(imidazo[1,2-a]pyrazin-3-ylmethyl)-N-[(3Z)-6,6,6-trifluoro-4-methoxy-5,5-dimethylhexa-1,3-dien-2-yl]-2,3-dihydroindole-6-carboxamide |
| SMILES | C=C(/C=C(\OC)C(C)(C)C(F)(F)F)NC(=O)c1ccc2c(c1)N(Cc1cnc3cnccn13)CC2 |
| InChI | InChI=1S/C25H26F3N5O2/c1-16(11-21(35-4)24(2,3)25(26,27)28)31-23(34)18-6-5-17-7-9-32(20(17)12-18)15-19-13-30-22-14-29-8-10-33(19)22/h5-6,8,10-14H,1,7,9,15H2,2-4H3,(H,31,34)/b21-11- |
| InChIKey | AHVZZNFRCLAJCG-NHDPSOOVSA-N |
| XLogP | 4.65 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|