C20H26F3N3O3S — CID 165142835
tert-butyl 3-[[(E)-1-amino-5,5,5-trifluoro-4,4-dimethylpent-2-enylidene]carbamoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 165142835) has the molecular formula C20H26F3N3O3S and a molecular weight of 445.51 g/mol. Its IUPAC name is tert-butyl 3-[[(E)-1-amino-5,5,5-trifluoro-4,4-dimethylpent-2-enylidene]carbamoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | tert-butyl 3-[[(E)-1-amino-5,5,5-trifluoro-4,4-dimethylpent-2-enylidene]carbamoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 165142835 |
| Molecular Formula | C20H26F3N3O3S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | tert-butyl 3-[[(E)-1-amino-5,5,5-trifluoro-4,4-dimethylpent-2-enylidene]carbamoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(C(=O)/N=C(N)/C=C/C(C)(C)C(F)(F)F)csc2C1 |
| InChI | InChI=1S/C20H26F3N3O3S/c1-18(2,3)29-17(28)26-9-7-12-13(11-30-14(12)10-26)16(27)25-15(24)6-8-19(4,5)20(21,22)23/h6,8,11H,7,9-10H2,1-5H3,(H2,24,25,27)/b8-6+ |
| InChIKey | WDKPOGJFJOTLFV-SOFGYWHQSA-N |
| XLogP | 4.68 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|