C24H34F2N2O3S — CID 165143284
tert-butyl 3-[[(3E,5E)-5-(1,1-difluoroethyl)hepta-1,3,5-trien-3-yl]carbamoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate;ethane (PubChem CID 165143284) has the molecular formula C24H34F2N2O3S and a molecular weight of 468.61 g/mol. Its IUPAC name is tert-butyl 3-[[(3E,5E)-5-(1,1-difluoroethyl)hepta-1,3,5-trien-3-yl]carbamoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate;ethane.
| Compound Name | tert-butyl 3-[[(3E,5E)-5-(1,1-difluoroethyl)hepta-1,3,5-trien-3-yl]carbamoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate;ethane |
|---|---|
| PubChem CID | 165143284 |
| Molecular Formula | C24H34F2N2O3S |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | tert-butyl 3-[[(3E,5E)-5-(1,1-difluoroethyl)hepta-1,3,5-trien-3-yl]carbamoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate;ethane |
| SMILES | C=C/C(=C\C(=C/C)C(C)(F)F)NC(=O)c1csc2c1CCN(C(=O)OC(C)(C)C)C2.CC |
| InChI | InChI=1S/C22H28F2N2O3S.C2H6/c1-7-14(22(6,23)24)11-15(8-2)25-19(27)17-13-30-18-12-26(10-9-16(17)18)20(28)29-21(3,4)5;1-2/h7-8,11,13H,2,9-10,12H2,1,3-6H3,(H,25,27);1-2H3/b14-7+,15-11+; |
| InChIKey | OGMXBERJZKXMRM-ZIYPITATSA-N |
| XLogP | 6.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|