C36H56N4OS — CID 165143069
(Z)-3-amino-N',4,4-trimethyl-N-[1-[6-[(E)-2-methylbut-2-enoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]ethenyl]pent-2-enimidamide;(4Z,6Z)-2,3,5,8-tetramethyldeca-2,4,6-triene (PubChem CID 165143069) has the molecular formula C36H56N4OS and a molecular weight of 592.94 g/mol. Its IUPAC name is (Z)-3-amino-N',4,4-trimethyl-N-[1-[6-[(E)-2-methylbut-2-enoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]ethenyl]pent-2-enimidamide;(4Z,6Z)-2,3,5,8-tetramethyldeca-2,4,6-triene.
| Compound Name | (Z)-3-amino-N',4,4-trimethyl-N-[1-[6-[(E)-2-methylbut-2-enoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]ethenyl]pent-2-enimidamide;(4Z,6Z)-2,3,5,8-tetramethyldeca-2,4,6-triene |
|---|---|
| PubChem CID | 165143069 |
| Molecular Formula | C36H56N4OS |
| Molecular Weight | 592.94 g/mol |
| Exact Mass | 592.42 |
| IUPAC Name | (Z)-3-amino-N',4,4-trimethyl-N-[1-[6-[(E)-2-methylbut-2-enoyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]ethenyl]pent-2-enimidamide;(4Z,6Z)-2,3,5,8-tetramethyldeca-2,4,6-triene |
| SMILES | C=C(NC(/C=C(\N)C(C)(C)C)=N\C)c1csc2c1CCN(C(=O)/C(C)=C/C)C2.CCC(C)/C=C\C(C)=C/C(C)=C(C)C |
| InChI | InChI=1S/C22H32N4OS.C14H24/c1-8-14(2)21(27)26-10-9-16-17(13-28-18(16)12-26)15(3)25-20(24-7)11-19(23)22(4,5)6;1-7-12(4)8-9-13(5)10-14(6)11(2)3/h8,11,13H,3,9-10,12,23H2,1-2,4-7H3,(H,24,25);8-10,12H,7H2,1-6H3/b14-8+,19-11-;9-8-,13-10- |
| InChIKey | WWKVUYCFJVWJBY-FVIZYRFNSA-N |
| XLogP | 8.97 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.94 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|